CymitQuimica logo

CAS 582-59-2

:

Indole-5,6-dione

Description:
Indole-5,6-dione, with the CAS number 582-59-2, is a bicyclic compound that belongs to the indole family, characterized by a fused benzene and pyrrole ring structure. This compound features a diketone functional group, specifically located at the 5 and 6 positions of the indole ring, which contributes to its reactivity and potential biological activity. Indole-5,6-dione is typically a yellow to orange crystalline solid, and it is known for its role in various chemical reactions, including cycloaddition and oxidation processes. The presence of the diketone moiety allows for the formation of derivatives through nucleophilic attack, making it a valuable intermediate in organic synthesis. Additionally, indole derivatives are of significant interest in medicinal chemistry due to their diverse pharmacological properties, including anti-inflammatory and anticancer activities. However, handling this compound requires caution, as it may pose health risks, and appropriate safety measures should be observed in laboratory settings.
Formula:C8H5NO2
InChI:InChI=1S/C8H5NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h1-4,9H
InChI key:InChIKey=IGGVVGHJSQSLFO-UHFFFAOYSA-N
SMILES:O=C1C=C2C(=CC1=O)NC=C2
Synonyms:
  • Indole-5,6-quinone
  • Indole-5,6-dione
  • 1H-Indole-5,6-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.