CymitQuimica logo

CAS 582-61-6

:

Benzoyl azide

Description:
Benzoyl azide is an organic compound characterized by its azide functional group (-N3) attached to a benzoyl moiety. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The compound is known for its high reactivity, particularly in the presence of heat or shock, which can lead to explosive decomposition. Benzoyl azide is used primarily in organic synthesis, particularly in the preparation of isocyanates and other nitrogen-containing compounds through the process of azide rearrangement. It is also utilized in click chemistry and as a precursor for various chemical transformations. Due to its azide group, it poses significant safety hazards, including toxicity and potential explosive properties, necessitating careful handling and storage. In terms of solubility, benzoyl azide is generally soluble in organic solvents but has limited solubility in water. Overall, its unique structure and reactivity make it a valuable compound in synthetic organic chemistry, albeit with associated risks.
Formula:C7H5N3O
InChI:InChI=1S/C7H5N3O/c8-10-9-7(11)6-4-2-1-3-5-6/h1-5H
InChI key:InChIKey=PJHUABJTDFXYRQ-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])(=O)C1=CC=CC=C1
Synonyms:
  • Benzoic acid azide
  • Benzazide
  • Benzoyl azide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.