CAS 58207-19-5: Clindamycin alcoholate
Description:Clindamycin alcoholate, with the CAS number 58207-19-5, is a chemical compound derived from clindamycin, an antibiotic used primarily to treat bacterial infections. This substance is characterized by its structural modification, which involves the addition of an alcohol moiety to the clindamycin framework. Clindamycin itself is a lincosamide antibiotic that works by inhibiting bacterial protein synthesis, making it effective against anaerobic bacteria and certain protozoa. The alcoholate form may exhibit altered solubility and stability compared to its parent compound, potentially influencing its pharmacokinetic properties. Typically, clindamycin and its derivatives are administered in various forms, including oral and topical preparations, and are known for their effectiveness against skin infections, respiratory tract infections, and certain types of bone infections. As with many antibiotics, the use of clindamycin alcoholate may be accompanied by considerations regarding resistance, side effects, and interactions with other medications. Overall, this compound represents an important aspect of antibiotic chemistry and pharmacology.
Formula:C18H34Cl2N2O5S
InChI:InChI=1/C18H33ClN2O5S.ClH/c1-5-6-10-7-11(21(3)8-10)17(25)20-12(9(2)19)16-14(23)13(22)15(24)18(26-16)27-4;/h9-16,18,22-24H,5-8H2,1-4H3,(H,20,25);1H/t9?,10-,11+,12?,13+,14-,15?,16?,18?;/m1./s1
- Synonyms:
- Clindamycin Hydrochloride Monohydrate