CymitQuimica logo

CAS 58211-82-8

:

4-(4'-chlorobiphenyl-4-yl)-2-methylidene-4-oxobutanoic acid

Description:
4-(4'-Chlorobiphenyl-4-yl)-2-methylidene-4-oxobutanoic acid, with the CAS number 58211-82-8, is an organic compound characterized by its complex structure, which includes a biphenyl moiety substituted with a chlorine atom and a functionalized butanoic acid. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in organic synthesis and materials science due to its unique structural features. The presence of the chlorobiphenyl group may impart specific electronic and steric properties, influencing its reactivity and interactions with other molecules. Additionally, the presence of the methylidene and keto functional groups suggests potential for tautomeric forms and reactivity in various chemical reactions, including condensation and addition reactions. Its solubility characteristics would depend on the solvent used, and it may exhibit interesting optical properties due to the conjugated system present in its structure. Overall, this compound represents a class of organic molecules that can be explored for various chemical applications, including pharmaceuticals and agrochemicals.
Formula:C17H13ClO3
InChI:InChI=1/C17H13ClO3/c1-11(17(20)21)10-16(19)14-4-2-12(3-5-14)13-6-8-15(18)9-7-13/h2-9H,1,10H2,(H,20,21)
SMILES:C=C(CC(=O)c1ccc(cc1)c1ccc(cc1)Cl)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 2-[2-(4'-Chloro-biphenyl-4-yl)-2-oxo-ethyl]acrylic Acid

    Controlled Product
    CAS:

    Applications 2-[2-(4’-Chloro-biphenyl-4-yl)-2-oxo-ethyl]acrylic Acid (cas# 58211-82-8) is a compound useful in organic synthesis.

    Formula:C17H13ClO3
    Color and Shape:Neat
    Molecular weight:300.74

    Ref: TR-C365055

    250mg
    219.00€