CymitQuimica logo

CAS 58211-94-2

:

3-(1-methyl-5-nitro-1H-imidazol-2-yl)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,2]oxazole

Description:
3-(1-methyl-5-nitro-1H-imidazol-2-yl)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,2]oxazole, with the CAS number 58211-94-2, is a complex organic compound characterized by its unique bicyclic structure that incorporates both imidazole and oxazole moieties. The presence of a nitro group on the imidazole ring contributes to its potential reactivity and biological activity. This compound is typically synthesized through multi-step organic reactions, which may involve cyclization and functional group transformations. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heteroatoms that can engage in various interactions with biological targets. The compound's solubility, stability, and reactivity can vary based on its environment and the presence of other functional groups. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, making it a subject of interest in drug discovery and development. However, specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C13H18N4O3
InChI:InChI=1/C13H18N4O3/c1-16-11(17(18)19)8-14-13(16)12-9-6-4-2-3-5-7-10(9)20-15-12/h8-10H,2-7H2,1H3
Synonyms:
  • 3a,4,5,6,7,8,9,9a-Octahydro-3-(1-methyl-5-nitroimidazol-2-yl)cycloocta(d)isoxazole
  • Cyclooct(d)isoxazole, 3a,4,5,6,7,8,9,9a-octahydro-3-(1-methyl-5-nitro-1H-imidazol-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.