CAS 58219-37-7
:pyrazinamide methiodide
Description:
Pyrazinamide methiodide is a chemical compound derived from pyrazinamide, which is primarily known for its use in the treatment of tuberculosis. This compound is characterized by its quaternary ammonium structure, which enhances its solubility and bioavailability. Pyrazinamide methiodide is typically a white to off-white crystalline powder, and it is soluble in water and other polar solvents. The methiodide form indicates the presence of a methyl iodide group, which can influence its pharmacological properties. In terms of biological activity, pyrazinamide itself acts by disrupting the mycobacterial cell membrane and inhibiting fatty acid synthesis, while the methiodide derivative may exhibit altered efficacy or toxicity profiles. Safety and handling precautions are essential due to the potential for toxicity associated with iodinated compounds. As with any pharmaceutical compound, thorough research and understanding of its pharmacodynamics, pharmacokinetics, and potential side effects are crucial for its application in medical settings.
Formula:C6H8IN3O
InChI:InChI=1/C6H7N3O.HI/c1-9-3-2-8-5(4-9)6(7)10;/h2-4H,1H3,(H-,7,10);1H
Synonyms:- pyrazinamide methiodide
- 3-Carbamoyl-1-methylpyrazin-1-ium iodide
- Pyrazinium, 3-(aminocarbonyl)-1-methyl-, iodide
- pyrazinium, 3-(aminocarbonyl)-1-methyl-, iodide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
