
CAS 5822-43-5
:Dextrallorphan
Description:
Dextrallorphan, with the CAS number 5822-43-5, is a synthetic compound that is structurally related to the opioid class of drugs. It is primarily recognized as an enantiomer of the drug dextromethorphan, which is commonly used as a cough suppressant. Dextrallorphan exhibits antitussive properties but is also noted for its potential psychoactive effects, although it is less potent than its counterpart. The compound is characterized by its ability to interact with the NMDA receptor and sigma receptors in the central nervous system, which may contribute to its effects. Dextrallorphan is typically administered in various formulations, including syrups and tablets, and is subject to regulatory scrutiny due to its potential for misuse. Its pharmacokinetics involve metabolism primarily in the liver, leading to various metabolites that may also exhibit biological activity. Overall, dextrallorphan is of interest in both therapeutic contexts and research, particularly in the study of its effects on the brain and its potential applications in treating conditions like cough and pain.
Formula:C19H25NO
InChI:InChI=1S/C19H25NO/c1-2-10-20-11-9-19-8-4-3-5-16(19)18(20)12-14-6-7-15(21)13-17(14)19/h2,6-7,13,16,18,21H,1,3-5,8-12H2/t16-,18+,19+/m1/s1
InChI key:InChIKey=OZYUPQUCAUTOBP-NEWSRXKRSA-N
SMILES:C(C=C)N1[C@@]2([C@@]3([C@@](C=4C(C2)=CC=C(O)C4)(CC1)CCCC3)[H])[H]
Synonyms:- Dextrallorphan
- Morphinan-3-ol, 17-(2-propenyl)-, (9α,13α,14α)-
- (9α,13α,14α)-17-(2-Propen-1-yl)morphinan-3-ol
- Morphinan-3-ol, 17-(2-propen-1-yl)-, (9α,13α,14α)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dextrallorphan
CAS:DXA is a morphinan used in research, acting as a σ1 agonist and NMDA antagonist, without significant affinity to other receptors.Formula:C19H25NOColor and Shape:SolidMolecular weight:283.41
