CymitQuimica logo

CAS 58226-19-0

:

4-Methyl-1-piperazinecarboxylic acid

Description:
4-Methyl-1-piperazinecarboxylic acid is an organic compound characterized by its piperazine ring structure, which is a six-membered cyclic amine. This compound features a carboxylic acid functional group and a methyl substituent on the piperazine ring, contributing to its unique chemical properties. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and pharmaceutical research, often serving as a building block for various bioactive molecules. Its structure allows for potential interactions with biological targets, making it relevant in the development of therapeutic agents. Additionally, 4-Methyl-1-piperazinecarboxylic acid may exhibit basic properties due to the nitrogen atoms in the piperazine ring, which can participate in hydrogen bonding and other interactions. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C6H12N2O2
InChI:InChI=1S/C6H12N2O2/c1-7-2-4-8(5-3-7)6(9)10/h2-5H2,1H3,(H,9,10)
InChI key:InChIKey=KNWWGBNAUNTSRV-UHFFFAOYSA-N
SMILES:C(O)(=O)N1CCN(C)CC1
Synonyms:
  • 4-Methyl-1-piperazinecarboxylic acid
  • N-Methylpiperazine-4-carboxylic acid
  • 1-Piperazinecarboxylic acid, 4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.