CAS 58228-93-6
:11'H-spiro[1,3-dioxolane-2,8'-pentacyclo[5.4.0.0~2,6~.0~3,10~.0~5,9~]undecan]-11'-one (non-preferred name)
Description:
11'H-spiro[1,3-dioxolane-2,8'-pentacyclo[5.4.0.0^2,6.0^3,10.0^5,9]undecan]-11'-one, with the CAS number 58228-93-6, is a complex organic compound characterized by its unique spirocyclic structure. This substance features a dioxolane ring fused to a pentacyclic framework, which contributes to its rigidity and potential stereochemical diversity. The presence of the carbonyl group (ketone) in its structure suggests reactivity typical of such functional groups, including potential for nucleophilic attack and participation in various organic reactions. The intricate arrangement of carbon atoms within the pentacyclic system may impart interesting physical properties, such as solubility and melting point, which can vary significantly based on the molecular interactions. Additionally, compounds with similar structures are often investigated for their biological activities, including potential pharmaceutical applications. However, specific data regarding its toxicity, stability, and reactivity would require further empirical studies to fully understand its behavior in various chemical environments.
Formula:C13H14O3
InChI:InChI=1/C13H14O3/c14-12-8-4-3-5-7-6(4)9(12)11(7)13(10(5)8)15-1-2-16-13/h4-11H,1-3H2
SMILES:C1COC2(C3C4CC5C6C4C2C6C(=O)C35)O1
Synonyms:- Spiro[1,3-dioxolane-2,8'-pentacyclo[5.4.0.02,?.03,1?.0?,?]undecan]-11'-one
- spiro[1,3-dioxolane-2,8'-pentacyclo[5.4.0.0^{2,6}.0^{3,10}.0^{5,9}]undecane]-11'-one
- RCL S18261
- Spiro[1,3-dioxolane-2,5'(1'aH)-[1,2,4]ethanylylidene[1H]cyclobuta[cd]pentalen]-7'-one, hexahydro-
- octahydrospiro[[1,3]dioxolane-2,5'-[2,4,1](epiethane[1,1,2]triyl)cyclobuta[cd]pentalen]-7'-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Spiro[1,3-dioxolane-2,8'-pentacyclo[5.4.0.0²,⁶.0³,¹⁰.0⁵,⁹]undecan]-11'-one
CAS:Spiro[1,3-dioxolane-2,8'-pentacyclo[5.4.0.0²,⁶.0³,¹⁰.0⁵,⁹]undecan]-11'-one is an organic compound that has a ketal group in its structure. It is also a hydrogen bond donor and a reductive coupling agent with properties of intramolecular hydrogen bonding and dimerization. The intramolecular hydrogen can be found in the ring of the spiro[1,3-dioxolane-2,8'-pentacyclo[5.4.0.0²,⁶.0³,¹⁰.0⁵,⁹]undecan]-11'-one that is bonded to the ketal group as well as on the benzene ring on the other side of the molecule when it is bound to another spiro[1
Formula:C13H14O3Purity:Min. 95%Molecular weight:218.25 g/molRef: 3D-ICA22893
Discontinued product
