CAS 58235-80-6
:methyl 4-bromofuran-2-carboxylate
Description:
Methyl 4-bromofuran-2-carboxylate is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. The presence of a bromine atom at the 4-position and a carboxylate group at the 2-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic furan ring. Methyl 4-bromofuran-2-carboxylate can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C6H5BrO3
InChI:InChI=1/C6H5BrO3/c1-9-6(8)5-2-4(7)3-10-5/h2-3H,1H3
SMILES:COC(=O)c1cc(co1)Br
Synonyms:- 2-Furancarboxylic Acid, 4-Bromo-, Methyl Ester
- Methyl 4-bromo-2-furoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 4-bromofuran-2-carboxylate
CAS:Formula:C6H5BrO3Purity:97%Color and Shape:SolidMolecular weight:205.00614-Bromofuran-2-carboxylic acid methyl ester
CAS:4-Bromofuran-2-carboxylic acid methyl esterPurity:98%Molecular weight:205.01g/molMethyl 4-bromofuran-2-carboxylate
CAS:Formula:C6H5BrO3Purity:95%Color and Shape:Solid, White powderMolecular weight:205.007Methyl 4-Bromofuran-2-carboxylate
CAS:Controlled ProductApplications Methyl 4-Bromofuran-2-carboxylate is used to prepare pyrimidinamines and pyridinamines as adenosine receptor modulators for treatment of CNS disorders.
References Borroni, E., et al.; PCT Int. Appl., WO 2001062233 A2 20010830 (2001)Formula:C6H5BrO3Color and Shape:NeatMolecular weight:205.01




