CAS 58236-74-1

(3-Bromophenyl)methanesulfonyl chloride

Description:

(3-Bromophenyl)methanesulfonyl chloride, with the CAS number 58236-74-1, is an organic compound characterized by the presence of a bromophenyl group attached to a methanesulfonyl chloride moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the sulfonyl chloride functional group, which can act as an electrophile in various chemical reactions. It is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water. The presence of the bromine atom enhances its electrophilic character, making it useful in synthetic organic chemistry, particularly in the formation of sulfonamides and other derivatives. Safety precautions are necessary when handling this compound, as it can be corrosive and may cause irritation to the skin, eyes, and respiratory system. Proper storage in a cool, dry place away from moisture is recommended to maintain its stability and reactivity.

Formula: C₇H₆BrClO₂S

InChI: InChI=1/C7H6BrClO2S/c8-7-3-1-2-6(4-7)5-12(9,10)11/h1-4H,5H2

SMILES: c1cc(cc(c1)Br)CS(=O)(=O)Cl

Synonyms:

• Benzenemethanesulfonyl chloride, 3-bromo-
• 3-Bromo-Benzyl-Sulfonyl-Chloride
• 3-Bromobenzylsulfonyl Chloride

3-Bromobenzylsulfonyl chloride

CAS: 58236-74-1

Formula: C₇H₆BrClO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 269.5433

Ref: IN-DA00ECA5

(3-Bromophenyl)methanesulphonyl chloride

CAS: 58236-74-1

(3-Bromophenyl)methanesulphonyl chloride

Formula: C₇H₆BrClO₂S

Purity: 95%

Color and Shape: light beige crystalline solid

Molecular weight: 269.54g/mol

Ref: 54-OR6077

3-Bromobenzylsulfonyl chloride

CAS: 58236-74-1

Formula: C₇H₆BrClO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 269.54

Ref: 10-F024385