CAS 58249-61-9
:6-Benzothiazolecarbonitrile
Description:
6-Benzothiazolecarbonitrile, with the CAS number 58249-61-9, is an organic compound characterized by its unique structure that combines a benzothiazole moiety with a cyano group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the benzothiazole ring contributes to its aromatic properties, while the cyano group enhances its reactivity and solubility in polar solvents. 6-Benzothiazolecarbonitrile may exhibit biological activity, making it of interest in medicinal chemistry for the development of new therapeutic agents. Additionally, its electronic properties can be leveraged in the design of organic semiconductors or dyes. The compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its handling and application. Overall, 6-Benzothiazolecarbonitrile is a versatile compound with significant potential in various chemical and industrial applications.
Formula:C8H4N2S
InChI:InChI=1S/C8H4N2S/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-3,5H
InChI key:InChIKey=WYRRTJKOMZONQO-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2C(=CC1)N=CS2
Synonyms:- 1,3-Benzothiazole-6-carbonitrile
- 6-Cyanobenzothiazol
- 6-Benzothiazolecarbonitrile
- 6-Cyanobenzothiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-BENZOTHIAZOLECARBONITRILE
CAS:Formula:C8H4N2SPurity:97%Color and Shape:SolidMolecular weight:160.19581,3-benzothiazole-6-carbonitrile
CAS:1,3-benzothiazole-6-carbonitrilePurity:≥95%Molecular weight:160.20g/mol1,3-Benzothiazole-6-carbonitrile
CAS:1,3-Benzothiazole-6-carbonitrile is a chemical compound that has been used as a cross-linking agent. It can be synthesized by reacting benzoyl chloride with nitrous acid and hydrochloric acid, yielding the dihydrate form. The compound is soluble in water and reacts with anions such as chloride to form salts. This reaction mechanism is similar to that of other cross-linking agents such as glutaraldehyde. 1,3-Benzothiazole-6-carbonitrile has shown an ability to react with carboxylic acids and benzothiazoles. It also has a spectrum that includes UV light, visible light, and infrared radiation. The compound can be used for cross-coupling reactions with anions and is biodegradable at high temperatures.
Formula:C8H4N2SPurity:Min. 95%Color and Shape:PowderMolecular weight:160.2 g/mol



