CAS 58256-08-9

3-(1a,10b-dihydro-6H-dibenzo[3,4:6,7]cyclohepta[1,2-b]oxiren-6-ylidene)-N,N-dimethylpropan-1-amine

Description:

The chemical substance known as "3-(1a,10b-dihydro-6H-dibenzo[3,4:6,7]cyclohepta[1,2-b]oxiren-6-ylidene)-N,N-dimethylpropan-1-amine" with the CAS number 58256-08-9 is a complex organic compound characterized by its unique bicyclic structure, which includes a dibenzo-cycloheptene framework and an oxirane moiety. This compound features a dimethylamino group, which contributes to its potential biological activity and solubility properties. The presence of the oxirane ring suggests that it may exhibit reactivity typical of epoxides, potentially allowing for further chemical transformations. Its structural complexity may influence its physical properties, such as melting point, boiling point, and solubility in various solvents. Additionally, the compound's stereochemistry and functional groups may play significant roles in its interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. However, specific data regarding its toxicity, stability, and applications would require further investigation and empirical studies.

Formula: C₂₀H₂₁NO

InChI: InChI=1/C20H21NO/c1-21(2)13-7-12-14-15-8-3-5-10-17(15)19-20(22-19)18-11-6-4-9-16(14)18/h3-6,8-12,19-20H,7,13H2,1-2H3

SMILES: CN(C)CCC=C1c2ccccc2C2C(c3ccccc13)O2

Cyclobenzaprine-10,11-Epoxide

CAS: 58256-08-9

Formula: C₂₀H₂₁NO

Molecular weight: 291.39

Ref: 4Z-C-3121

Cyclobenzaprine-10,11-epoxide

CAS: 58256-08-9

Formula: C₂₀H₂₁NO

Molecular weight: 291.39

Ref: ST-EA-CP-C85010

Cyclobenzaprine-10,11-epoxide

Controlled Product

CAS: 58256-08-9

Applications Cyclobenzaprine-10,11-epoxide is the impurity of Cyclobenzaprine Hydrochloride C987750, which is used as a muscle relaxant (skeletal).
References Cotton, M.L., et al.: Anal. Profiles Drug Subs., 17, 41 (1988),

Formula: C₂₀H₂₁NO

Color and Shape: Neat

Molecular weight: 291.387

Ref: TR-C947750