CAS 58258-01-8
:4-(diphenylmethoxy)piperidine
Description:
4-(Diphenylmethoxy)piperidine is an organic compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The compound features a diphenylmethoxy group, where two phenyl rings are attached to a methoxy group that is further connected to the piperidine nitrogen. This structure contributes to its potential as a pharmacological agent, particularly in the field of medicinal chemistry. The presence of the diphenylmethoxy moiety enhances lipophilicity, which can influence the compound's ability to cross biological membranes and interact with various receptors. Additionally, the nitrogen atom in the piperidine ring can participate in hydrogen bonding, affecting the compound's solubility and reactivity. 4-(Diphenylmethoxy)piperidine may exhibit biological activity, making it of interest for research in drug development. Its CAS number, 58258-01-8, allows for easy identification in chemical databases and literature. As with many organic compounds, its properties can be influenced by factors such as temperature, solvent, and concentration.
Formula:C18H21NO
InChI:InChI=1/C18H21NO/c1-3-7-15(8-4-1)18(16-9-5-2-6-10-16)20-17-11-13-19-14-12-17/h1-10,17-19H,11-14H2
SMILES:c1ccc(cc1)C(c1ccccc1)OC1CCNCC1
Synonyms:- Piperidine, 4-(Diphenylmethoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(Diphenylmethoxy)piperidine
CAS:Formula:C18H21NOPurity:97%Color and Shape:SolidMolecular weight:267.3654Desalkyl ebastine
CAS:Desalkyl ebastine is a drug that inhibits the CYP2J2 enzyme and P-glycoprotein (P-gp) to increase the bioavailability of other drugs. It has been shown to have a high affinity for human cytochrome P450 2J2 (CYP2J2) and P-glycoprotein (P-gp). Desalkyl ebastine is used in wastewater treatment and biological treatment, where it can be used to reduce phosphodiesterase activity. It has been found to be metabolized by CYP3A4 and CYP1A2 enzymes in humans. The pharmacokinetics of desalkyl ebastine are complex because it is metabolized by multiple enzymes. Desalkyl ebastine also has anti-allergic properties that may be due to its ability to inhibit phosphodiesterase activity.
Formula:C18H21NOPurity:Min. 95%Molecular weight:267.37 g/mol





