CAS 58262-07-0
:2,5-Di(methoxy-d<sub>3</sub>)-4-methylbenzaldehyde
Description:
2,5-Di(methoxy-d3)-4-methylbenzaldehyde is a deuterated aromatic aldehyde, characterized by the presence of two methoxy groups and a methyl group on a benzene ring, along with an aldehyde functional group. The deuteration (indicated by "d3") suggests that three hydrogen atoms in the methoxy groups are replaced by deuterium, which is a stable isotope of hydrogen. This modification can enhance the compound's utility in various applications, particularly in NMR spectroscopy, where deuterated compounds provide clearer spectra due to reduced background noise from hydrogen signals. The presence of the aldehyde group makes this compound reactive, allowing it to participate in various chemical reactions, such as condensation and oxidation. Additionally, the methoxy groups can influence the compound's solubility, polarity, and reactivity, making it a valuable intermediate in organic synthesis and potentially useful in the development of pharmaceuticals or agrochemicals. Overall, 2,5-Di(methoxy-d3)-4-methylbenzaldehyde is a versatile compound with significant implications in both research and industrial applications.
Formula:C10H6D6O3
InChI:InChI=1S/C10H12O3/c1-7-4-10(13-3)8(6-11)5-9(7)12-2/h4-6H,1-3H3/i2D3,3D3
InChI key:InChIKey=LRSRTWLEJBIAIT-XERRXZQWSA-N
SMILES:C(=O)C1=C(OC([2H])([2H])[2H])C=C(C)C(OC([2H])([2H])[2H])=C1
Synonyms:- Benzaldehyde, 2,5-di(methoxy-d3)-4-methyl-
- 2,5-Di(methoxy-d3)-4-methylbenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,5-Dimethoxy-d6-4-methyl-benzaldehyde
CAS:Controlled ProductApplications Used in the preparation of labelled phenylamine derivative as potential psychotomimetics.
References Nichols, D. et al.: J. Med. Chem. 17, 161 (1974).Formula:C10H6D6O3Color and Shape:NeatMolecular weight:186.24
