CAS 58271-38-8

3-[(2,4-dimethylphenyl)amino]-3-oxopropanoic acid

Description:

3-[(2,4-Dimethylphenyl)amino]-3-oxopropanoic acid, with the CAS number 58271-38-8, is an organic compound characterized by its structure, which includes an amino group attached to a propanoic acid backbone. This compound features a ketone functional group (3-oxo) and a substituted aromatic ring (2,4-dimethylphenyl), contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound may participate in various chemical reactions, including acylation and amination, making it of interest in synthetic organic chemistry. Its potential applications could span pharmaceuticals and agrochemicals, given the presence of both the amino and carboxylic acid functionalities, which are often involved in biological activity. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1/C11H13NO3/c1-7-3-4-9(8(2)5-7)12-10(13)6-11(14)15/h3-5H,6H2,1-2H3,(H,12,13)(H,14,15)

SMILES: Cc1ccc(c(C)c1)N=C(CC(=O)O)O

Synonyms:

• Propanoic Acid, 3-[(2,4-Dimethylphenyl)Amino]-3-Oxo-

3-[(2,4-dimethylphenyl)amino]-3-oxopropanoic acid

CAS: 58271-38-8

Formula: C₁₁H₁₃NO₃

Purity: 95.0%

Molecular weight: 207.229

Ref: 10-F310161