CAS 5828-70-6
:dl-4-chloro-2-(alpha-methylbenzyl)phenol
Description:
dl-4-Chloro-2-(alpha-methylbenzyl)phenol, with the CAS number 5828-70-6, is an organic compound characterized by its phenolic structure, which includes a chlorine atom and an alpha-methylbenzyl group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. It exhibits properties associated with phenolic compounds, such as antioxidant activity and the ability to act as a disinfectant or antiseptic. The presence of the chlorine atom can influence its reactivity and solubility in different solvents. Additionally, the alpha-methylbenzyl group may contribute to its hydrophobic characteristics, affecting its interaction with biological systems. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, dl-4-chloro-2-(alpha-methylbenzyl)phenol is a compound of interest in chemical research and industrial applications, warranting further investigation into its properties and uses.
Formula:C14H13ClO
InChI:InChI=1/C14H13ClO/c1-10(11-5-3-2-4-6-11)13-9-12(15)7-8-14(13)16/h2-10,16H,1H3
InChI key:InChIKey=FOIOLHANQROKIC-UHFFFAOYSA-N
SMILES:C(C)(C1=C(O)C=CC(Cl)=C1)C2=CC=CC=C2
Synonyms:- 4-Chloro-2-(1-Phenylethyl)Phenol
- Phenol, 4-chloro-2-(1-phenylethyl)-
- Phenol, 4-chloro-2-(α-methylbenzyl)-
- dl-4-Chloro-2-(alpha-methylbenzyl)phenol
- o-Phenylethyl-p-Chlorophenol
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery