CAS 58282-51-2
:1-[2-Hydroxy-5-(2-hydroxyethyl)phenyl]ethanone
Description:
1-[2-Hydroxy-5-(2-hydroxyethyl)phenyl]ethanone, also known by its CAS number 58282-51-2, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group and an ethanone moiety. This compound typically appears as a solid or viscous liquid and is soluble in organic solvents due to its polar functional groups. Its molecular structure suggests it may exhibit properties such as antioxidant activity, making it of interest in various applications, including cosmetics and pharmaceuticals. The presence of multiple hydroxyl groups enhances its potential for hydrogen bonding, influencing its reactivity and interactions with other substances. Additionally, this compound may undergo typical organic reactions such as esterification or oxidation, depending on the conditions. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken. Overall, 1-[2-Hydroxy-5-(2-hydroxyethyl)phenyl]ethanone is a versatile compound with potential utility in diverse fields.
Formula:C10H12O3
InChI:InChI=1S/C10H12O3/c1-7(12)9-6-8(4-5-11)2-3-10(9)13/h2-3,6,11,13H,4-5H2,1H3
InChI key:InChIKey=CIGAEGPITWAFGF-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC(CCO)=CC=C1O
Synonyms:- 1-[2-Hydroxy-5-(2-hydroxyethyl)phenyl]ethanone
- 3-Acetyl-4-hydroxyphenethyl alcohol
- Ethanone, 1-[2-hydroxy-5-(2-hydroxyethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[2-Hydroxy-5-(2-hydroxyethyl)phenyl]-ethanone
CAS:Controlled ProductApplications 1-[2-Hydroxy-5-(2-hydroxyethyl)phenyl]-ethanone (cas# 58282-51-2) is a compound useful in organic synthesis.
Formula:C10H12O3Color and Shape:NeatMolecular weight:180.2
