CAS 5829-48-1
:9,10-dichlorooctadecanoic acid
Description:
9,10-Dichlorooctadecanoic acid, with the CAS number 5829-48-1, is a chlorinated fatty acid characterized by the presence of two chlorine atoms at the 9th and 10th carbon positions of the octadecanoic acid (stearic acid) chain. This compound typically appears as a white to off-white solid and is soluble in organic solvents but has limited solubility in water due to its long hydrophobic hydrocarbon chain. The presence of chlorine atoms introduces unique chemical properties, such as increased reactivity and potential biological activity, which can influence its behavior in various chemical environments. It is often studied for its potential applications in biochemistry, particularly in the context of lipid metabolism and as a model compound for understanding the effects of chlorinated organic compounds in biological systems. Safety considerations are important, as chlorinated compounds can exhibit toxicity and environmental persistence. Proper handling and disposal methods should be employed to mitigate any potential risks associated with this substance.
Formula:C18H34Cl2O2
InChI:InChI=1/C18H34Cl2O2/c1-2-3-4-5-7-10-13-16(19)17(20)14-11-8-6-9-12-15-18(21)22/h16-17H,2-15H2,1H3,(H,21,22)
SMILES:CCCCCCCCC(C(CCCCCCCC(=O)O)Cl)Cl
Synonyms:- 9,10-Dichlorostearic Acid
- Octadecanoic Acid, 9,10-Dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
9,10-Dichlorostearic acid
CAS:9,10-Dichlorostearic acid, a chlorinated antimutagen, damages tumor cell membranes, causing ATP leakage.Formula:C18H34Cl2O2Color and Shape:SolidMolecular weight:353.379,10-Dichlorostearic Acid
CAS:Controlled ProductFormula:C18H34Cl2O2Color and Shape:NeatMolecular weight:353.367


