
CAS 58298-76-3
:(3aR,6Z,9R,10aS,11aS)-2,3,3a,10,10a,11a-Hexahydro-3,3,6,9,11a-pentamethyl-1H-dicyclopenta[a,d]cyclononene-1,5,11(4H,9H)-trione
Description:
The chemical substance with the name "(3aR,6Z,9R,10aS,11aS)-2,3,3a,10,10a,11a-Hexahydro-3,3,6,9,11a-pentamethyl-1H-dicyclopenta[a,d]cyclononene-1,5,11(4H,9H)-trione" and CAS number "58298-76-3" is a complex organic compound characterized by its unique polycyclic structure. It features multiple fused rings, which contribute to its stability and potential reactivity. The presence of multiple methyl groups indicates a high degree of substitution, which can influence its physical properties, such as melting and boiling points, as well as its solubility in various solvents. The compound contains functional groups that suggest it may exhibit specific chemical reactivity, particularly in relation to electrophilic or nucleophilic interactions. Its stereochemistry, denoted by the specific configuration at various chiral centers, plays a crucial role in determining its biological activity and interaction with other molecules. Overall, this compound's intricate structure and functional groups make it of interest in fields such as organic synthesis, materials science, and potentially medicinal chemistry.
Formula:C20H26O3
InChI:InChI=1S/C20H26O3/c1-11-6-13-8-12(2)15(21)9-16-19(3,4)10-17(22)20(16,5)18(23)14(13)7-11/h6,8,11,14,16H,7,9-10H2,1-5H3/b12-8-/t11-,14-,16+,20-/m0/s1
InChI key:InChIKey=TYBGBKQPLBAYQG-CJIMKZOCSA-N
SMILES:C[C@]12[C@@](C(C)(C)CC1=O)(CC(=O)\C(\C)=C/C=3[C@@](C2=O)(C[C@@H](C)C3)[H])[H]
Synonyms:- NSC 254668
- (3aR,6Z,9R,10aS,11aS)-2,3,3a,10,10a,11a-Hexahydro-3,3,6,9,11a-pentamethyl-1H-dicyclopenta[a,d]cyclononene-1,5,11(4H,9H)-trione
- Jatrophatrione
- 1H-Dicyclopenta[a,d]cyclononene-1,5,11(4H,9H)-trione, 2,3,3a,10,10a,11a-hexahydro-3,3,6,9,11a-pentamethyl-, [3aR-(3aR*,6Z,9R*,10aS*,11aS*)]-
- 1H-Dicyclopenta[a,d]cyclononene-1,5,11(4H,9H)-trione, 2,3,3a,10,10a,11a-hexahydro-3,3,6,9,11a-pentamethyl-, (3aR,6Z,9R,10aS,11aS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Jatrophatrione
CAS:Jatrophatrione is a type of bioactive mesotricyclic diterpenoid.Formula:C20H26O3Color and Shape:SolidMolecular weight:314.42
