CAS 583-23-3

(2-chloro-4-methylphenoxy)acetic acid

Description:

(2-Chloro-4-methylphenoxy)acetic acid, with the CAS number 583-23-3, is an organic compound that belongs to the class of phenoxyacetic acids. It is characterized by the presence of a chloro group and a methyl group on the aromatic ring, which influences its chemical reactivity and biological activity. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents, with limited solubility in water. It exhibits herbicidal properties, making it useful in agricultural applications for controlling broadleaf weeds. The presence of the phenoxyacetic acid moiety contributes to its ability to mimic plant hormones, particularly auxins, which can disrupt normal plant growth processes. Additionally, (2-chloro-4-methylphenoxy)acetic acid may undergo various chemical reactions, including esterification and substitution, due to its functional groups. Safety data indicates that, like many chemical substances, it should be handled with care, following appropriate safety protocols to minimize exposure and environmental impact.

Formula: C₉H₉ClO₃

InChI: InChI=1/C9H9ClO3/c1-6-2-3-8(7(10)4-6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12)

SMILES: Cc1ccc(c(c1)Cl)OCC(=O)O

(2-Chloro-4-methyl-phenoxy)-acetic acid

CAS: 583-23-3

Formula: C₉H₉ClO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.6190

Ref: IN-DA00EJYL

2-(2-Chloro-4-methylphenoxy)acetic acid

CAS: 583-23-3

2-(2-Chloro-4-methylphenoxy)acetic acid

Purity: 95%

Molecular weight: 200.62g/mol

Ref: 54-OR75511

2-(2-Chloro-4-methylphenoxy)acetic acid

CAS: 583-23-3

Purity: 95%

Molecular weight: 200.6199951

Ref: 10-F687538

2-(2-Chloro-4-methylphenoxy)acetic acid

Controlled Product

CAS: 583-23-3

2-Chloro-4-methylphenoxyacetic acid is a pesticide that functions as a plant growth regulator. It is used to control broadleaf weeds, annual grasses, and woody plants. 2-Chloro-4-methylphenoxyacetic acid is considered an endocrine disruptor and may cause reproductive effects. 2-Chloro-4-methylphenoxyacetic acid has been detected in human tissue samples at concentrations up to 100 times higher than the average population. This chemical can be found in food products such as meat, poultry, fish, eggs, and dairy products. The highest concentrations of this chemical are found in oilseed crops such as soybeans and rapeseed. There is evidence that suggests that 2-chloro-4-methylphenoxyacetic acid could cause malformations in fetuses during pregnancy or childhood if exposed to high concentrations during intrauterine development.

Formula: C₉H₉ClO₃

Purity: Min. 95%

Molecular weight: 200.62 g/mol

Ref: 3D-AAA58323