CAS 583057-48-1
:Arasertaconazole
Description:
Arasertaconazole is an antifungal agent belonging to the class of triazole compounds, primarily used in the treatment of various fungal infections. It exhibits a broad spectrum of activity against dermatophytes, yeasts, and other fungi by inhibiting the synthesis of ergosterol, a vital component of fungal cell membranes. This mechanism disrupts cell membrane integrity, leading to fungal cell death. Arasertaconazole is characterized by its high potency and favorable pharmacokinetic properties, which enhance its efficacy in clinical applications. The compound is typically administered topically, making it suitable for treating localized infections with minimal systemic absorption. Its chemical structure includes a triazole ring, which is essential for its antifungal activity. Additionally, Arasertaconazole has been noted for its low toxicity profile, making it a safer option for patients. As with any antifungal treatment, resistance can develop, so monitoring and appropriate use are essential to maintain its effectiveness. Overall, Arasertaconazole represents a valuable option in the antifungal therapeutic arsenal.
Formula:C20H15Cl3N2OS
InChI:InChI=1S/C20H15Cl3N2OS/c21-14-4-5-16(18(23)8-14)19(9-25-7-6-24-12-25)26-10-13-11-27-20-15(13)2-1-3-17(20)22/h1-8,11-12,19H,9-10H2/t19-/m0/s1
InChI key:InChIKey=JLGKQTAYUIMGRK-IBGZPJMESA-N
SMILES:C(O[C@@H](CN1C=CN=C1)C2=C(Cl)C=C(Cl)C=C2)C=3C=4C(SC3)=C(Cl)C=CC4
Synonyms:- 1H-Imidazole, 1-[(2R)-2-[(7-chlorobenzo[b]thien-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-
- Arasertaconazole
- 1-[(2R)-2-[(7-Chlorobenzo[b]thien-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-Sertaconazole
CAS:Controlled ProductFormula:C20H15Cl3N2OSColor and Shape:NeatMolecular weight:437.77(R)-Sertaconazole
CAS:(R)-Sertaconazole is a crystalline polymorph of sertaconazole, an antifungal drug. The polymorphs of sertaconazole are important diagnostic agents for the identification of fungal infections. (R)-Sertaconazole has also been shown to have anti-fungal and antimicrobial properties against human pathogens such as Candida species, Cryptococcus neoformans, and Aspergillus fumigatus. The most effective form of treatment for these infections is in the form of dry powders containing (R)-sertaconazole. These powders are inhaled by humans to treat respiratory diseases caused by these fungi.Formula:C20H15Cl3N2OSPurity:Min. 95%Molecular weight:437.8 g/molArasertaconazole
CAS:Arasertaconazole, a sterol-14-alpha demethylation inhibitor, is used potentially for the treatment of vulvovaginal candcanidiasis.Formula:C20H15Cl3N2OSColor and Shape:SolidMolecular weight:437.77




