CAS 58306-67-5
:N-[2-Amino-5-(phenylthio)phenyl]-2-methoxyacetamide
Description:
N-[2-Amino-5-(phenylthio)phenyl]-2-methoxyacetamide, with the CAS number 58306-67-5, is an organic compound characterized by its amide functional group and the presence of both amino and methoxy groups. This compound features a phenylthio substituent, which contributes to its unique chemical properties and potential biological activity. The molecular structure includes a methoxy group attached to an acetamide moiety, enhancing its solubility in organic solvents. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, N-[2-Amino-5-(phenylthio)phenyl]-2-methoxyacetamide is a compound of interest for further research, particularly in the fields of drug development and organic synthesis.
Formula:C15H16N2O2S
InChI:InChI=1S/C15H16N2O2S/c1-19-10-15(18)17-14-9-12(7-8-13(14)16)20-11-5-3-2-4-6-11/h2-9H,10,16H2,1H3,(H,17,18)
InChI key:InChIKey=CTJWFLXXSAXYMS-UHFFFAOYSA-N
SMILES:S(C1=CC(NC(COC)=O)=C(N)C=C1)C2=CC=CC=C2
Synonyms:- Acetamide, N-[2-amino-5-(phenylthio)phenyl]-2-methoxy-
- 2′-Amino-2-methoxy-5′-(phenylthio)acetanilide
- N-[2-Amino-5-(phenylthio)phenyl]-2-methoxyacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
