CAS 58313-23-8
:3-Iodobenzoic acid ethyl ester
Description:
3-Iodobenzoic acid ethyl ester is an organic compound characterized by its structure, which includes a benzoic acid moiety substituted with an iodine atom at the meta position and an ethyl ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to the hydrophobic nature of the aromatic ring and the ethyl ester group. The presence of the iodine atom imparts unique reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions in organic synthesis. Additionally, 3-iodobenzoic acid ethyl ester can serve as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as iodine-containing compounds can be hazardous. Proper storage conditions are also essential to maintain its stability and prevent degradation.
Formula:C9H9IO2
InChI:InChI=1/C9H9IO2/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3
SMILES:CCOC(=O)c1cccc(c1)I
Synonyms:- Ethyl 3-iodobenzoate
- Ethyl iodobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethyl 3-Iodobenzoate
CAS:Formula:C9H9IO2Purity:>98.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:276.07Ethyl 3-iodobenzoate, min. 98%
CAS:Formula:C9H9IO2Purity:min. 98%Color and Shape:Colorless to pale-yellow liquidMolecular weight:276.07Ethyl 3-iodobenzoate
CAS:Ethyl 3-iodobenzoateFormula:C9H9IO2Purity:98%Color and Shape: brown liquidMolecular weight:276.07g/molEthyl 3-iodobenzoate
CAS:Ethyl 3-iodobenzoate (EIB) is a catalytic reagent that is used in the synthesis of terminal alkynes. It has been shown to be highly reactive with chloride and transmetallates to form ethyl 3-chlorobenzoate. The reaction time between EIB and chloride can be decreased by adding magnesium to the reaction mixture. This reagent also reacts with thymic acid, a synthon for many thiols, forming ethyl 3-thiophenoate. Ethyl 3-iodobenzoate can also act as an affinity label for halides and heterocycles.Formula:C9H9IO2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:276.07 g/mol






