CAS 58314-93-5

(12Z)-7,8,9,10-tetrahydroazepino[2,1-b]quinazolin-12(6H)-imine

Description:

(12Z)-7,8,9,10-tetrahydroazepino[2,1-b]quinazolin-12(6H)-imine is a chemical compound characterized by its complex bicyclic structure, which includes a quinazoline moiety fused to a tetrahydroazepine ring. This compound features a double bond configuration at the 12-position, denoted by the "Z" designation, indicating that the substituents are on the same side of the double bond. The presence of the imine functional group contributes to its reactivity and potential biological activity. The compound is likely to exhibit properties typical of nitrogen-containing heterocycles, such as potential pharmacological effects, due to its structural features. Its CAS number, 58314-93-5, allows for easy identification in chemical databases. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Further studies would be necessary to elucidate its specific applications and interactions in various chemical contexts.

Formula: C₁₃H₁₅N₃

InChI: InChI=1/C13H15N3/c14-13-10-6-3-4-7-11(10)15-12-8-2-1-5-9-16(12)13/h3-4,6-7,14H,1-2,5,8-9H2/b14-13-

SMILES: C1CCc2nc3ccccc3c(=N)n2CC1

6H,7H,8H,9H,10H,12H-Azepino[2,1-b]quinazolin-12-imine

CAS: 58314-93-5

Versatile small molecule scaffold

Formula: C₁₃H₁₅N₃

Purity: Min. 95%

Molecular weight: 213.28 g/mol

Ref: 3D-ICA31493