CAS 58316-42-0
:Saikosaponin B3
Description:
Saikosaponin B3 is a triterpenoid saponin primarily derived from the roots of the plant Bupleurum falcatum, commonly known for its use in traditional medicine. This compound is characterized by its complex structure, which includes a steroid-like backbone with multiple sugar moieties attached, contributing to its solubility and biological activity. Saikosaponin B3 exhibits a range of pharmacological properties, including anti-inflammatory, hepatoprotective, and immunomodulatory effects. It has been studied for its potential therapeutic applications in various conditions, including liver diseases and cancer. The compound's mechanism of action often involves modulation of signaling pathways and inhibition of pro-inflammatory cytokines. Additionally, Saikosaponin B3 is recognized for its potential to enhance the efficacy of certain chemotherapeutic agents. However, further research is necessary to fully elucidate its mechanisms and therapeutic potential. As with many natural products, the bioavailability and pharmacokinetics of Saikosaponin B3 can vary, influencing its effectiveness in clinical applications.
Formula:C43H72O14
InChI:InChI=1S/C43H72O14/c1-21-29(48)34(57-36-32(51)31(50)30(49)25(18-44)55-36)33(52)37(54-21)56-28-10-11-39(4)26(40(28,5)19-45)9-12-41(6)35(39)24(53-8)15-22-23-16-38(2,3)13-14-43(23,20-46)27(47)17-42(22,41)7/h15,21,23-37,44-52H,9-14,16-20H2,1-8H3/t21-,23+,24-,25-,26-,27+,28+,29+,30-,31+,32-,33-,34+,35-,36+,37+,39+,40+,41-,42-,43-/m1/s1
InChI key:InChIKey=GLQYFMRUYWFXGT-ZGFARVGISA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)([C@@](CO)(C)[C@@H](O[C@H]4[C@H](O)[C@@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@@H](C)O4)CC3)[H])([C@H](OC)C=C6[C@@]2(C)C[C@H](O)[C@]7(CO)[C@]6(CC(C)(C)CC7)[H])[H]
Synonyms:- β-D-Galactopyranoside, (3β,4α,11α,16β)-16,23,28-trihydroxy-11-methoxyolean-12-en-3-yl 6-deoxy-3-O-β-D-glucopyranosyl-
- Saikosaponin B3
- Oleanane, β-D-galactopyranoside deriv.
- (3β,4α,11α,16β)-16,23,28-Trihydroxy-11-methoxyolean-12-en-3-yl 6-deoxy-3-O-β-D-glucopyranosyl-β-D-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(1-Isopropyl-4-piperidyl)methanamine; dihydrochloride
CAS:Formula:C43H72O14Purity:98%Molecular weight:813.0234Saikosaponin b3
CAS:Saikosaponin b3 from Bupleurum falcatum roots, blocks ACTH lipolysis in fat cells, has pain relief properties.Formula:C43H72O14Purity:99.91%Color and Shape:SolidMolecular weight:813.02Saikosaponin B3
CAS:Saikosaponin B3 is a triterpenoid saponin, which is a bioactive compound sourced from plants of the Bupleurum species. Saikosaponins are primarily extracted from the roots of these plants, which are widely utilized in traditional medicine, particularly in East Asian practices. The mode of action of Saikosaponin B3 includes modulation of the immune response, anti-inflammatory effects, and potential anti-cancer properties. It operates by inhibiting specific signaling pathways such as NF-kB and modulating cytokine production, which are crucial in inflammatory and immune responses.
Formula:C43H72O14Purity:Min. 95%Molecular weight:813.04 g/mol





