CymitQuimica logo

CAS 5832-43-9

:

4-methyl-5-nitro-pyridine-2-carboxylic acid

Description:
4-Methyl-5-nitro-pyridine-2-carboxylic acid is an organic compound characterized by its pyridine ring structure, which includes a methyl group and a nitro group as substituents. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the nitro group typically enhances the compound's reactivity, making it useful in various chemical syntheses and applications. It is a solid at room temperature and is soluble in polar solvents, which is common for carboxylic acids. The compound's molecular structure allows for potential interactions in biological systems, and it may exhibit antimicrobial or herbicidal properties, making it of interest in pharmaceutical and agricultural chemistry. Additionally, its unique functional groups can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, further expanding its utility in organic synthesis. Safety data should be consulted for handling, as nitro compounds can be hazardous.
Formula:C7H6N2O4
InChI:InChI=1/C7H6N2O4/c1-4-2-5(7(10)11)8-3-6(4)9(12)13/h2-3H,1H3,(H,10,11)
InChI key:WRCSKWMCSRGUTG-UHFFFAOYSA-N
SMILES:Cc1cc(C(=O)O)ncc1N(=O)=O
Synonyms:
  • 2-Pyridinecarboxylic Acid, 4-Methyl-5-Nitro-
  • 4-Methyl-5-nitropyridine-2-carboxylic acid
Found 4 products.