CymitQuimica logo

CAS 58327-75-6

:

3-Aminothieno[2,3-b]pyridine-2-carboxylic acid

Description:
3-Aminothieno[2,3-b]pyridine-2-carboxylic acid is a heterocyclic compound characterized by the presence of both a thieno and pyridine ring structure, which contributes to its unique chemical properties. This compound features an amino group and a carboxylic acid functional group, making it an amino acid derivative. The thieno and pyridine rings provide a planar structure that can facilitate interactions with biological targets, potentially influencing its pharmacological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound's molecular structure allows for hydrogen bonding, which can enhance its reactivity and interaction with other molecules. Additionally, its unique arrangement of heteroatoms can influence its electronic properties, making it of interest in medicinal chemistry and drug development. Overall, 3-Aminothieno[2,3-b]pyridine-2-carboxylic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H6N2O2S
InChI:InChI=1S/C8H6N2O2S/c9-5-4-2-1-3-10-7(4)13-6(5)8(11)12/h1-3H,9H2,(H,11,12)
InChI key:InChIKey=HGKGNTBBCCWIRD-UHFFFAOYSA-N
SMILES:NC=1C=2C(SC1C(O)=O)=NC=CC2
Synonyms:
  • Nsc 284503
  • Thieno[2,3-b]pyridine-2-carboxylic acid, 3-amino-
  • 3-Aminothieno(2,3-b)pyridine-2-carboxylic acid
  • 3-Aminothieno[2,3-b]pyridine-2-carboxylic acid
Found 5 products.