CAS 58337-16-9
:ethyl 4-oxo-2-(phenylamino)-4,5-dihydrofuran-3-carboxylate
Description:
Ethyl 4-oxo-2-(phenylamino)-4,5-dihydrofuran-3-carboxylate, with the CAS number 58337-16-9, is a chemical compound characterized by its unique structure that includes a furan ring, a carbonyl group, and an ethyl ester functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in organic solvents. The presence of the phenylamino group suggests that it may engage in hydrogen bonding and other interactions, influencing its biological activity and chemical behavior. Ethyl 4-oxo-2-(phenylamino)-4,5-dihydrofuran-3-carboxylate may be of interest in medicinal chemistry due to its structural features, which could be relevant in the development of pharmaceuticals or agrochemicals. Its synthesis and applications would likely involve standard organic reactions, including esterification and cyclization processes. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C13H13NO4
InChI:InChI=1/C13H13NO4/c1-2-17-13(16)11-10(15)8-18-12(11)14-9-6-4-3-5-7-9/h3-7,14H,2,8H2,1H3
SMILES:CCOC(=O)C1=C(Nc2ccccc2)OCC1=O
Synonyms:- 3-Furancarboxylic acid, 4,5-dihydro-4-oxo-2-(phenylamino)-, ethyl ester
- 4-Oxo-2-phenylamino-4,5-dihydro-furan-3-carboxylic acid ethyl ester
- Ethyl 2-anilino-4-oxo-4,5-dihydrofuran-3-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethyl 4-oxo-2-(phenylamino)-4,5-dihydrofuran-3-carboxylate
CAS:Formula:C13H13NO4Color and Shape:SolidMolecular weight:247.2466Ethyl 2-anilino-4-oxo-4,5-dihydro-3-furancarboxylate
CAS:Ethyl 2-anilino-4-oxo-4,5-dihydro-3-furancarboxylate is a reactive compound that inhibits the mitochondrial membrane potential. It also has anti-tumor and anti-proliferative activities. This compound's membrane potential inhibitory effect is due to its ability to generate reactive oxygen species (ROS) in a mitochondria membrane. ROS are toxic and can lead to cell death. The anti-proliferative activity of ethyl 2-anilino-4-oxo-4,5-dihydro-3-furancarboxylate may be due to its ability to activate caspase 3.Formula:C13H13NO4Purity:Min. 95%Molecular weight:247.25 g/mol

