CAS 5834-25-3

N-(dibenzo[b,d]furan-3-yl)acetamide

Description:

N-(dibenzo[b,d]furan-3-yl)acetamide is an organic compound characterized by its unique structure, which features a dibenzo[b,d]furan moiety attached to an acetamide group. This compound typically exhibits properties associated with both aromatic and amide functionalities, contributing to its potential biological activity. The dibenzo[b,d]furan structure provides a rigid, planar configuration, which can influence its interactions with biological targets. The presence of the acetamide group may enhance solubility in polar solvents and facilitate hydrogen bonding, impacting its reactivity and stability. N-(dibenzo[b,d]furan-3-yl)acetamide may also exhibit fluorescence properties due to its conjugated system, making it of interest in various applications, including pharmaceuticals and materials science. Its CAS number, 5834-25-3, allows for easy identification in chemical databases. Overall, this compound's unique structural features and potential functional properties make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₁NO₂

InChI: InChI=1/C14H11NO2/c1-9(16)15-10-6-7-12-11-4-2-3-5-13(11)17-14(12)8-10/h2-8H,1H3,(H,15,16)

SMILES: CC(=Nc1ccc2c3ccccc3oc2c1)O

Synonyms:

• acetamide, N-3-dibenzofuranyl-

N-{8-Oxatricyclo[7.4.0.0,2,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl}acetamide

CAS: 5834-25-3

Versatile small molecule scaffold

Formula: C₁₄H₁₁NO₂

Purity: Min. 95%

Molecular weight: 225.24 g/mol

Ref: 3D-FAA83425