CAS 5834-63-9

1,8,15,22-tetraazacyclooctacosane-2,9,16,23-tetrone

Description:

1,8,15,22-Tetraazacyclooctacosane-2,9,16,23-tetrone, with CAS number 5834-63-9, is a complex organic compound characterized by its unique cyclic structure and multiple functional groups. This substance features a macrocyclic framework composed of a total of 28 carbon atoms, interspersed with nitrogen atoms that contribute to its tetraaza (four nitrogen) configuration. The presence of four ketone functional groups (tetrone) at specific positions enhances its reactivity and potential applications in coordination chemistry. The compound is typically soluble in polar solvents due to its polar functional groups, and its structure allows for the formation of metal complexes, making it of interest in fields such as catalysis and materials science. Additionally, the nitrogen atoms in the ring can participate in hydrogen bonding and coordination with metal ions, which may influence its chemical behavior and stability. Overall, this compound exemplifies the intricate relationship between structure and reactivity in organic chemistry.

Formula: C₂₄H₄₄N₄O₄

InChI: InChI=1/C24H44N4O4/c29-21-13-5-1-9-17-25-22(30)14-6-2-11-19-27-24(32)16-8-4-12-20-28-23(31)15-7-3-10-18-26-21/h1-20H2,(H,25,30)(H,26,29)(H,27,32)(H,28,31)

SMILES: C1CCC(=NCCCCCC(=NCCCCCC(=NCCCCCC(=NCC1)O)O)O)O

Synonyms:

• 1,8,15,22-Tetraazacyclooctacosane-2,9,16,23-tetrone

1,8,15,22-tetrazacyclooctacosane-2,9,16,23-tetrone

CAS: 5834-63-9

Formula: C₂₄H₄₄N₄O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 452.6306

Ref: IN-DA00EZSP

Caprolactam Impurity 1

CAS: 5834-63-9

Formula: C₂₄H₄₄N₄O₄

Molecular weight: 452.64

Ref: 4Z-C-458004

1,8,15,22-Tetraazacyclononacosane-2,9,16,23-tetrone

Controlled Product

CAS: 5834-63-9

Applications 1,8,15,22-Tetraazacyclononacosane-2,9,16,23-tetrone is used in biological study as a metabolite of Corynebacterium Aurantiacum.
References Fukumura, T. et al.: Jou. of Fer. Tec., 60(5), 469-72, (1982)

Formula: C₂₄H₄₄N₄O₄

Color and Shape: Neat

Molecular weight: 452.631

Ref: TR-T596750

1,8,15,22-Tetraazacyclononacosane-2,9,16,23-tetrone

CAS: 5834-63-9

1,8,15,22-Tetraazacyclononacosane-2,9,16,23-tetrone is a potent inhibitor of kinases that have been shown to be involved in the growth and survival of cancer cells. This compound was isolated from Chinese urine and has been found to induce apoptosis in cancer cells by inhibiting kinase activity. The analogs of this compound have been developed as anticancer agents due to their ability to inhibit cyclin-dependent kinases (CDKs) that are involved in cell cycle regulation. This inhibitor has shown promising results in preclinical studies for the treatment of various types of tumors, including breast cancer and lung cancer. It is a potential candidate for further development as an anticancer drug due to its high specificity towards human kinases and low toxicity towards healthy cells.

Formula: C₂₄H₄₄N₄O₄

Purity: Min. 95%

Molecular weight: 452.6 g/mol

Ref: 3D-FAA83463