CAS 58347-49-2

7-chloropyrazolo[1,5-a]pyrimidine

Description:

7-Chloropyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, with a chlorine substituent at the 7-position of the pyrazole ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals targeting various diseases. The presence of the chlorine atom can influence its reactivity and solubility, making it a subject of interest in drug design. The compound's molecular structure contributes to its unique electronic properties, which can affect its interaction with biological targets. Additionally, 7-chloropyrazolo[1,5-a]pyrimidine may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the presence of electron-rich nitrogen atoms in its structure. Overall, this compound represents a valuable entity in the field of organic synthesis and medicinal chemistry, with ongoing research into its applications and mechanisms of action.

Formula: C₆H₄ClN₃

InChI: InChI=1/C6H4ClN3/c7-5-1-3-8-6-2-4-9-10(5)6/h1-4H

SMILES: c1cnc2ccnn2c1Cl

Synonyms:

• Pyrazolo[1,5-A]Pyrimidine, 7-Chloro-

7-Chloropyrazolo[1,5-A]Pyrimidine

CAS: 58347-49-2

Formula: C₆H₄ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.5691

Ref: IN-DA00EE7C

7-Chloropyrazolo[1,5-a]pyrimidine

CAS: 58347-49-2

7-Chloropyrazolo[1,5-a]pyrimidine

Purity: 98%

Molecular weight: 153.57g/mol

Ref: 54-OR951521

7-Chloropyrazolo[1,5-a]pyrimidine

CAS: 58347-49-2

Formula: C₆H₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.57

Ref: 10-F093583