CAS 58349-01-2

4-bromo-2-chloro-6-nitrophenol

Description:

4-Bromo-2-chloro-6-nitrophenol is an organic compound characterized by the presence of a phenolic ring substituted with bromine, chlorine, and nitro groups. Its molecular structure features a bromine atom at the para position, a chlorine atom at the ortho position, and a nitro group at the meta position relative to the hydroxyl group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for halogenated phenolic compounds. The presence of multiple electronegative substituents influences its reactivity, making it a candidate for electrophilic aromatic substitution reactions. Additionally, the nitro group contributes to its acidity, while the halogen substituents can affect its biological activity and environmental persistence. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.

Formula: C₆H₃BrClNO₃

InChI: InChI=1/C6H3BrClNO3/c7-3-1-4(8)6(10)5(2-3)9(11)12/h1-2,10H

SMILES: c1c(cc(c(c1Cl)O)N(=O)=O)Br

Synonyms:

• 4-BROMO-2-CHLORO-6-NITROPHENOL

4-BROMO-2-CHLORO-6-NITROPHENOL

CAS: 58349-01-2

Formula: C₆H₃BrClNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 252.4499

Ref: IN-DA00EKPA

4-Bromo-2-chloro-6-nitrophenol

CAS: 58349-01-2

4-Bromo-2-chloro-6-nitrophenol

Formula: C₆H₃BrClNO₃

Purity: ≥95%

Color and Shape: bright yellow solid

Molecular weight: 252.45g/mol

Ref: 54-OR400331

4-Bromo-2-chloro-6-nitrophenol

CAS: 58349-01-2

Formula: C₆H₃BrClNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 252.45

Ref: 10-F050646