CAS 58351-19-2

2-(4-phenyl-1,3-thiazol-2-yl)acetamide

Description:

2-(4-phenyl-1,3-thiazol-2-yl)acetamide is an organic compound characterized by its thiazole and acetamide functional groups. It features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms, contributing to its unique chemical properties. The presence of the phenyl group enhances its aromatic characteristics and may influence its reactivity and solubility. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. It is of interest in medicinal chemistry due to its potential biological activities, which may include antimicrobial or anti-inflammatory properties. The molecular structure allows for various interactions, making it a candidate for further research in drug development. Additionally, its CAS number, 58351-19-2, serves as a unique identifier for regulatory and safety information. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₁H₁₀N₂OS

InChI: InChI=1/C11H10N2OS/c12-10(14)6-11-13-9(7-15-11)8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,12,14)

SMILES: c1ccc(cc1)c1csc(CC(=N)O)n1

Synonyms:

• 2-Thiazoleacetamide, 4-phenyl-

2-(4-Phenyl-1,3-thiazol-2-yl)acetamide

CAS: 58351-19-2

2-(4-Phenyl-1,3-thiazol-2-yl)acetamide

Purity: 97%

Molecular weight: 218.27g/mol

Ref: 54-OR8145

2-(4-phenyl-1,3-thiazol-2-yl)acetamide

Controlled Product

CAS: 58351-19-2

Stability No Data Availabe
Applications 2-(4-phenyl-1,3-thiazol-2-yl)acetamide (cas# 58351-19-2) is a useful research chemical.

Formula: C₁₁H₁₀N₂OS

Color and Shape: Neat

Molecular weight: 218.27

Ref: TR-P322885

2-(4-Phenyl-1,3-thiazol-2-yl)acetamide

CAS: 58351-19-2

Versatile small molecule scaffold

Formula: C₁₁H₁₀N₂OS

Purity: Min. 95%

Molecular weight: 218.28 g/mol

Ref: 3D-ICA35119