CAS 58356-65-3: Manganese (III) meso-tetraphenylporphine acetate
Description:Manganese (III) meso-tetraphenylporphine acetate is a coordination compound featuring a manganese ion coordinated to a porphyrin ligand, specifically meso-tetraphenylporphine, which is a macrocyclic compound known for its ability to bind metal ions. This compound typically exhibits a deep color, often purple or violet, due to the electronic transitions within the porphyrin ring. The manganese in the +3 oxidation state contributes to its unique redox properties, making it a subject of interest in various fields, including catalysis and biological mimetics. The acetate group attached to the porphyrin enhances solubility and stability in organic solvents. Manganese (III) meso-tetraphenylporphine acetate is also known for its potential applications in photodynamic therapy and as a model for studying heme-containing enzymes. Its stability, electronic properties, and ability to participate in electron transfer reactions make it a valuable compound in both synthetic and biological chemistry. Safety precautions should be observed when handling this compound, as with many metal-containing substances.
Formula:C47H34MnN4O2
InChI:InChI=1/C45H31N4.C2H4O2.Mn/c1-49-40-28-29-41(49)45(33-20-12-5-13-21-33)39-27-25-37(48-39)43(31-16-8-3-9-17-31)35-23-22-34(46-35)42(30-14-6-2-7-15-30)36-24-26-38(47-36)44(40)32-18-10-4-11-19-32;1-2(3)4;/h2-29H,1H3;1H3,(H,3,4);/q-2;;+3/p-1/b42-34-,42-36-,43-35-,43-37-,44-38-,44-40-,45-39-,45-41-;;/rC45H31MnN4.C2H4O2/c1-47-34-22-23-35(47)43(31-16-8-3-9-17-31)37-25-27-39-45(33-20-12-5-13-21-33)41-29-28-40-44(32-18-10-4-11-19-32)38-26-24-36(42(34)30-14-6-2-7-15-30)48(38)46(49(37)39)50(40)41;1-2(3)4/h2-29H,1H3;1H3,(H,3,4)/q+1;/p-1/b42-34-,42-36-,43-35-,43-37-;