CAS 58359-53-8: 4-(2-Phenyldiazenyl)benzenesulfonyl chloride
Description:4-(2-Phenyldiazenyl)benzenesulfonyl chloride, with the CAS number 58359-53-8, is an organic compound characterized by its sulfonyl chloride functional group attached to a diazenyl aromatic system. This compound typically appears as a solid at room temperature and is known for its vibrant color due to the presence of the diazenyl group, which can impart significant electronic properties. It is soluble in organic solvents such as dichloromethane and chloroform but is generally insoluble in water. The sulfonyl chloride moiety makes it a reactive compound, capable of undergoing nucleophilic substitution reactions, which can be utilized in various synthetic applications, including the preparation of sulfonamides and other derivatives. Additionally, due to its azo structure, it may exhibit interesting optical properties, making it potentially useful in dye chemistry. However, handling this compound requires caution due to its reactivity and potential health hazards associated with sulfonyl chlorides, including irritation to skin and respiratory pathways.
Formula:C12H9ClN2O2S
InChI:InChI=1S/C12H9ClN2O2S/c13-18(16,17)12-8-6-11(7-9-12)15-14-10-4-2-1-3-5-10/h1-9H
InChI key:InChIKey=UEAZPVORQYDKHZ-UHFFFAOYSA-N
SMILES:O=S(=O)(Cl)C1=CC=C(N=NC=2C=CC=CC2)C=C1
- Synonyms:
- 4-(2-Phenyldiazenyl)benzenesulfonyl chloride
- 4-(Phenylazo)benzenesulfonyl chloride
- 4-[(E)-phenyldiazenyl]benzenesulfonyl chloride
- Azobenzene-4-sulfonyl chloride
- Benzenesulfonyl chloride, 4-(2-phenyldiazenyl)-
- Benzenesulfonyl chloride, 4-(phenylazo)-
- Benzenesulfonyl chloride, p-phenylazo-
- Phenylazobenzenesulfonylchloride
- p-(Phenylazo)benzenesulfonyl chloride
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Azobenzene-4-sulfonyl Chloride REF: 3B-A1050CAS: 58359-53-8 | >98.0%(T) | 118.00 € | Mon 07 Apr 25 |
 | 4-PHENYLAZOBENZENESULFONYL CHLORIDE REF: IN-DA003LZ8CAS: 58359-53-8 | 98% | 123.00 €~155.00 € | Mon 14 Apr 25 |
 | 4-Phenylazobenzenesulfonyl chloride REF: 3D-FP162218CAS: 58359-53-8 | Min. 95% | - - - | Discontinued product |
Azobenzene-4-sulfonyl Chloride
Ref: 3B-A1050
| 5g | 118.00 € |
4-PHENYLAZOBENZENESULFONYL CHLORIDE
Ref: IN-DA003LZ8
| 1g | 123.00 € |
4-Phenylazobenzenesulfonyl chloride
Ref: 3D-FP162218
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
