CAS 58364-97-9

5-hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid

Description:

5-Hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid, with the CAS number 58364-97-9, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) that contribute to its acidic properties and potential for hydrogen bonding. The presence of the methyl group (-CH3) at the 1-position of the pyrazole ring influences its solubility and reactivity. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical applications. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its structural characteristics allow for potential interactions in biological systems, which could lead to various therapeutic applications. As with many organic compounds, proper handling and safety measures should be observed due to its chemical nature.

Formula: C₅H₆N₂O₃

InChI: InChI=1/C5H6N2O3/c1-7-4(8)2-3(6-7)5(9)10/h2,8H,1H3,(H,9,10)

SMILES: Cn1c(cc(C(=O)O)n1)O

Synonyms:

• 1H-pyrazole-3-carboxylic acid, 5-hydroxy-1-methyl-
• 5-Hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid

5-hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid

CAS: 58364-97-9

Formula: C₅H₆N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 142.1127

Ref: IN-DA00EJTO

5-Hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid

CAS: 58364-97-9

5-Hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid

Formula: C₅H₆N₂O₃

Purity: 95%

Color and Shape: Off-White Powder

Molecular weight: 142.11g/mol

Ref: 54-OR12623

5-Hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid

CAS: 58364-97-9

Formula: C₅H₆N₂O₃

Purity: 97%

Molecular weight: 142.114

Ref: 10-F319057

5-Hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid

CAS: 58364-97-9

5-Hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid (5HMPCA) is a potent inhibitor of matrix metalloproteases (MMPs). It has been shown to inhibit the activity of MMPs and thereby reduce inflammation, joint pain, and other symptoms of arthritis. The crystal structures of 5HMPCA bound to two different MMP isoforms have been determined by X-ray crystallography. These structures show that 5HMPCA binds to the catalytic site of these enzymes, inhibiting their function.

Formula: C₅H₆N₂O₃

Purity: Min. 95%

Molecular weight: 142.11 g/mol

Ref: 3D-ICA36497