CAS 58373-29-8

Methyltriphenoxy[[(trifluoromethyl)sulfonyl]oxy]phosphorane

Description:

Methyltriphenoxy[(trifluoromethyl)sulfonyl]oxyphosphorane, with the CAS number 58373-29-8, is a chemical compound characterized by its unique structure that includes a phosphorane core. This compound features a methyl group, three phenoxy groups, and a trifluoromethylsulfonyl moiety, which contribute to its reactivity and stability. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. Methyltriphenoxyphosphoranes are typically used in organic synthesis and may serve as intermediates in the preparation of various phosphorous-containing compounds. The compound's phosphorane structure suggests it may exhibit properties such as nucleophilicity and the ability to participate in various chemical reactions, including those involving electrophiles. Additionally, the trifluoromethylsulfonyl group can impart unique electronic properties, making it a valuable component in designing pharmaceuticals or agrochemicals. Safety data and handling precautions should be considered due to the potential toxicity associated with phosphoranes and sulfonyl compounds.

Formula: C₂₀H₁₈F₃O₆PS

InChI: InChI=1S/C20H18F3O6PS/c1-30(26-17-11-5-2-6-12-17,27-18-13-7-3-8-14-18,28-19-15-9-4-10-16-19)29-31(24,25)20(21,22)23/h2-16H,1H3

InChI key: InChIKey=GOTMFHPUXXRQCE-UHFFFAOYSA-N

SMILES: P(OS(C(F)(F)F)(=O)=O)(OC1=CC=CC=C1)(OC2=CC=CC=C2)(OC3=CC=CC=C3)C

Synonyms:

• Methyl(Triphenoxy){[(Trifluoromethyl)Sulfonyl]Oxy}-Lambda~5~-Phosphane
• Methyltriphenoxy[[(trifluoromethyl)sulfonyl]oxy]phosphorane
• Methyltriphenoxyphosphonium triflate
• Phosphorane, methyltriphenoxy[[(trifluoromethyl)sulfonyl]oxy]-
• Methyltriphenoxyphosphonium trifluoromethanesulphonate

Methyltriphenoxyphosphonium Trifluoromethanesulfonate

Controlled Product

CAS: 58373-29-8

Methyltriphenoxyphosphonium Trifluoromethanesulfonate is a reagent for the synthesis of alkenes, ethers, nitriles, esters and alkanes. It is also used to synthesize heterocycles. Methyltriphenoxyphosphonium Trifluoromethanesulfonate can be used to synthesise a wide variety of organic compounds. It reacts with electrophiles such as alcohols, amines and carboxylic acids to produce the corresponding ethers, nitriles, esters or alkanes. This reagent can also be used in many different cross-coupling reactions such as Suzuki-Miyaura reaction or Sonogashira reaction.

Formula: C₂₀H₁₈F₃O₆PS

Purity: Min. 95%

Molecular weight: 474.39 g/mol

Ref: 3D-FM93386