CAS 58373-38-9
:5-nitro-6-phenylpiperidin-2-one
Description:
5-Nitro-6-phenylpiperidin-2-one is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a nitro group at the 5-position and a phenyl group at the 6-position contributes to its unique chemical properties. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the phenyl group. The nitro group introduces polar characteristics, which can influence its reactivity and interactions with other molecules. 5-Nitro-6-phenylpiperidin-2-one may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its structure allows for various chemical modifications, which can enhance its efficacy or alter its pharmacokinetic properties. As with many nitro compounds, it may also exhibit sensitivity to reduction reactions, making it a candidate for further chemical transformations in synthetic applications. Safety and handling precautions should be observed due to the potential toxicity associated with nitro-containing compounds.
Formula:C11H12N2O3
InChI:InChI=1/C11H12N2O3/c14-10-7-6-9(13(15)16)11(12-10)8-4-2-1-3-5-8/h1-5,9,11H,6-7H2,(H,12,14)
SMILES:c1ccc(cc1)C1C(CCC(=N1)O)N(=O)=O
Synonyms:- 2-Piperidinone, 5-Nitro-6-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.