CAS 58381-23-0

1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose

Description:

1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose is a carbohydrate derivative characterized by its furanose ring structure, which is a five-membered ring containing four carbon atoms and one oxygen atom. This compound features three benzyl groups attached to the hydroxyl positions at carbons 2, 3, and 5 of the ribofuranose, enhancing its hydrophobic properties and stability. The presence of an acetyl group at the anomeric carbon (C-1) contributes to its reactivity and solubility in organic solvents. This compound is typically used in organic synthesis and carbohydrate chemistry, serving as a glycosyl donor or intermediate in the preparation of more complex glycosides. Its structure allows for selective reactions, making it valuable in the synthesis of nucleosides and other biologically relevant molecules. Additionally, the benzyl protecting groups can be removed under specific conditions, allowing for further functionalization of the ribofuranose moiety. Overall, 1-O-acetyl-2,3,5-tri-O-benzyl-D-ribofuranose is an important building block in the field of synthetic organic chemistry.

Formula: C₂₈H₃₀O₆

InChI: InChI=1/C28H30O6/c1-21(29)33-28-27(32-19-24-15-9-4-10-16-24)26(31-18-23-13-7-3-8-14-23)25(34-28)20-30-17-22-11-5-2-6-12-22/h2-16,25-28H,17-20H2,1H3/t25-,26-,27-,28?/m1/s1

SMILES: CC(=O)OC1[C@@H]([C@@H]([C@@H](COCc2ccccc2)O1)OCc1ccccc1)OCc1ccccc1

1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose

CAS: 58381-23-0

Molecular weight: 462.53

Ref: 7W-GC3288

1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose

CAS: 58381-23-0

1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose

Purity: >98%

Molecular weight: 462.53g/mol

Ref: 54-BICL4034

1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose

CAS: 58381-23-0

Apogossypol is a polyunsaturated fatty acid that has been shown to have anticancer and anti-inflammatory properties. Studies have shown that apogossypol inhibits the production of proinflammatory cytokines and nitric oxide, which are compounds that can cause inflammation. Apogossypol also has been shown to inhibit apoptosis in cancer cells, which is a programmed cell death process. Apogossypol may be useful as an anticancer agent due to its ability to induce apoptosis and inhibit inflammation in cancer cells.

Formula: C₂₈H₃₀O₆

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 462.53 g/mol

Ref: 3D-MA05708

1-O-Acetyl-2,3,5-Tri-O-Benzyl-D-Ribofuranose extrapure, 98%

CAS: 58381-23-0

Formula: C₂₈H₃₀O₆

Molecular weight: 462.53

Ref: SR-32993