CAS 583840-03-3
:4-[4-({[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methylpyridine-2-carboxamide 1-oxide
Description:
4-[4-({[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methylpyridine-2-carboxamide 1-oxide, with CAS number 583840-03-3, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amides, phenoxy, and a pyridine moiety. This compound features a chloro and trifluoromethyl substituent on the aromatic ring, contributing to its unique chemical properties, including potential lipophilicity and reactivity. The presence of the N-methyl group and the carboxamide functionality suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with biological targets. As a result, this compound may be of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, the compound's intricate structure and functional groups make it a subject of interest in medicinal chemistry and material science.
Formula:C21H16ClF3N4O4
InChI:InChI=1/C21H16ClF3N4O4/c1-26-19(30)18-11-15(8-9-29(18)32)33-14-5-2-12(3-6-14)27-20(31)28-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,27,28,31)
SMILES:CNC(=O)c1cc(ccn1=O)Oc1ccc(cc1)NC(=Nc1ccc(c(c1)C(F)(F)F)Cl)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(4-(3-(4-Chloro-3-(trifluoromethyl)phenyl)ureido)phenoxy)-2-(methylcarbamoyl)pyridine 1-oxide
CAS:4-(4-(3-(4-Chloro-3-(trifluoromethyl)phenyl)ureido)phenoxy)-2-(methylcarbamoyl)pyridine 1-oxidePurity:97%Molecular weight:480.83g/molSorafenib N-oxide
CAS:Sorafenib N-oxide, active sorafenib metabolite, inhibits FLT3-ITD (Kd=70 nM), targets AML, selectivity for FLT3-ITD+, also mixes CYP3A4 inhibitor (Ki=15 μM).Formula:C21H16ClF3N4O4Color and Shape:SolidMolecular weight:480.83Sorafenib N-Oxide
CAS:Controlled ProductFormula:C21H16ClF3N4O4Color and Shape:BeigeMolecular weight:480.82Sorafenib N-oxide
CAS:Sorafenib N-oxide is a potent anti-angiogenic agent that inhibits the growth and proliferation of new blood vessels. It has been shown to inhibit the production of epidermal growth factor, which plays an important role in the formation of new blood vessels. Sorafenib N-oxide also induces apoptosis in cancer cells by inhibiting cell factor and stem cell factor, which are necessary for cell survival. This drug has been shown to be effective against metastatic colorectal cancer in animal models, as well as renal cell cancer in humans. Sorafenib N-oxide also causes mitochondrial membrane depolarization, leading to cell death. In addition, this drug has antiangiogenic properties and inhibits the Mcl-1 protein.Formula:C21H16ClF3N4O4Purity:Min. 95%Color and Shape:Beige PowderMolecular weight:480.82 g/mol





