CAS 583860-52-0

1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyethanone

Description:

1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-hydroxyethanone, with the CAS number 583860-52-0, is an organic compound characterized by its unique structural features, including a benzodioxin moiety and a hydroxyethanone functional group. This compound typically exhibits a molecular structure that includes a fused dioxin ring system, contributing to its potential reactivity and interaction with biological systems. The presence of the hydroxy group enhances its solubility in polar solvents and may influence its biological activity, making it of interest in medicinal chemistry. The compound may also display various physical properties such as melting point, boiling point, and solubility, which are essential for understanding its behavior in different environments. Additionally, its potential applications could span across pharmaceuticals, agrochemicals, or as a synthetic intermediate in organic synthesis. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature reviews.

Formula: C₁₀H₁₀O₄

InChI: InChI=1/C10H10O4/c11-6-8(12)7-1-2-9-10(5-7)14-4-3-13-9/h1-2,5,11H,3-4,6H2

SMILES: c1cc2c(cc1C(=O)CO)OCCO2

Synonyms:

• Ethanone, 1-(2,3-Dihydro-1,4-Benzodioxin-6-Yl)-2-Hydroxy-

1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyethanone

CAS: 583860-52-0

Formula: C₁₀H₁₀O₄

Purity: 95.0%

Molecular weight: 194.186

Ref: 10-F314552