CAS 584-20-3
:3-Amino-4,4,4-trifluorobutyric acid
Description:
3-Amino-4,4,4-trifluorobutyric acid is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a butyric acid backbone. Its molecular structure features a central butyric acid moiety with three fluorine atoms substituted at the alpha position, which significantly influences its chemical properties. This compound is typically a white crystalline solid and is soluble in polar solvents due to the presence of the carboxylic acid and amino functional groups. The trifluoromethyl group imparts unique electronic properties, enhancing its reactivity and potential applications in pharmaceuticals and agrochemicals. It may exhibit biological activity, making it of interest in medicinal chemistry. Additionally, the presence of fluorine atoms can affect the compound's lipophilicity and metabolic stability. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose environmental and health risks. Overall, 3-Amino-4,4,4-trifluorobutyric acid is a versatile compound with significant implications in various chemical and biological fields.
Formula:C4H6F3NO2
InChI:InChI=1/C4H6F3NO2/c5-4(6,7)2(8)1-3(9)10/h2H,1,8H2,(H,9,10)/t2-/m0/s1
SMILES:C([C@@H](C(F)(F)F)N)C(=O)O
Synonyms:- 3-Amino-4,4,4-trifluorobutanoic acid
- Butanoic acid, 3-amino-4,4,4-trifluoro-
- (3S)-3-ammonio-4,4,4-trifluorobutanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-4,4,4-trifluorobutyric acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C4H6F3NO2Purity:97%Color and Shape:White, PowderMolecular weight:157.093-Amino-4,4,4-trifluorobutanoic acid
CAS:3-Amino-4,4,4-trifluorobutanoic acidPurity:97%Color and Shape:White PowderMolecular weight:157.09g/mol3-Amino-4,4,4-trifluorobutyric acid
CAS:Formula:C4H6F3NO2Purity:97%Color and Shape:Solid, CrystalsMolecular weight:157.092



