CAS 584-87-2: 3-formyl-4-hydroxybenzoic acid

Description:3-Formyl-4-hydroxybenzoic acid, with the CAS number 584-87-2, is an organic compound that belongs to the class of aromatic carboxylic acids. It features a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to a benzene ring, specifically at the 3 and 4 positions, respectively. This compound is characterized by its white to pale yellow crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to its functional groups. The presence of both the hydroxyl and carboxylic acid groups contributes to its acidity and reactivity, making it a useful intermediate in organic synthesis and a potential candidate for various applications in pharmaceuticals and materials science. Additionally, it can participate in hydrogen bonding, influencing its physical properties and interactions with other molecules. Its unique structure allows for various chemical transformations, making it valuable in the development of more complex organic compounds.

Formula:C₈H₆O₄

InChI:InChI=1/C8H6O4/c9-4-6-3-5(8(11)12)1-2-7(6)10/h1-4,10H,(H,11,12)

Synonyms:
4-Hydroxy-5-Formylbenzoic Acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3-Formyl-4-hydroxybenzoic acid REF: IN-DA003JHYCAS: 584-87-2	98%	To inquire	Wed 23 Apr 25
3-Formyl-4-hydroxybenzoic acid REF: 54-OR322820CAS: 584-87-2	99%	32.00 €~1,694.00 €	Thu 24 Apr 25
3-Formyl-4-hydroxybenzoic acid REF: 10-F329349CAS: 584-87-2	95.0%	20.00 €~1,034.00 €	Mon 28 Apr 25
3-Formyl-4-hydroxybenzoic acid REF: 3D-FF34543CAS: 584-87-2	90%	147.00 €~729.00 €	Tue 06 May 25