CAS 584-87-2

3-formyl-4-hydroxybenzoic acid

Description:

3-Formyl-4-hydroxybenzoic acid, with the CAS number 584-87-2, is an organic compound that belongs to the class of aromatic carboxylic acids. It features a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to a benzene ring, specifically at the 3 and 4 positions, respectively. This compound is characterized by its white to pale yellow crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to its functional groups. The presence of both the hydroxyl and carboxylic acid groups contributes to its acidity and reactivity, making it a useful intermediate in organic synthesis and a potential candidate for various applications in pharmaceuticals and materials science. Additionally, it can participate in hydrogen bonding, influencing its physical properties and interactions with other molecules. Its unique structure allows for various chemical transformations, making it valuable in the development of more complex organic compounds.

Formula: C₈H₆O₄

InChI: InChI=1/C8H6O4/c9-4-6-3-5(8(11)12)1-2-7(6)10/h1-4,10H,(H,11,12)

SMILES: c1cc(c(cc1C(=O)O)C=O)O

Synonyms:

• 4-Hydroxy-5-Formylbenzoic Acid

3-Formyl-4-hydroxybenzoic acid

CAS: 584-87-2

Formula: C₈H₆O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.1308

Ref: IN-DA003JHY

3-Formyl-4-hydroxybenzoic acid

CAS: 584-87-2

3-Formyl-4-hydroxybenzoic acid

Purity: 99%

Molecular weight: 166.13g/mol

Ref: 54-OR322820

3-Formyl-4-hydroxybenzoic acid

CAS: 584-87-2

3-Formyl-4-hydroxybenzoic acid is a synthetic compound with anticancer activity. It is an azobenzene that has been shown to have photocatalytic activity. 3-Formyl-4-hydroxybenzoic acid has a carboxylate functional group and the ethyl ester functional group. The anticancer activity of this compound may be due to hydrogen bonding interactions, as well as its ability to cause DNA damage in cells by photolysis and its antiviral potency.

Formula: C₈H₆O₄

Purity: 90%

Color and Shape: White Powder

Molecular weight: 166.13 g/mol

Ref: 3D-FF34543

3-Formyl-4-hydroxybenzoic acid

CAS: 584-87-2

Formula: C₈H₆O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.132

Ref: 10-F329349