CAS 584-94-1: (±)-2,3-Dimethylhexane

Description: (±)-2,3-Dimethylhexane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. It has the molecular formula C8H18, indicating it consists of eight carbon atoms and eighteen hydrogen atoms. This compound features two methyl groups attached to the second and third carbon atoms of a hexane backbone, resulting in a chiral structure with two enantiomers. As a colorless liquid at room temperature, (±)-2,3-dimethylhexane is characterized by its relatively low boiling point and moderate viscosity compared to other hydrocarbons. It is insoluble in water but soluble in organic solvents, making it useful in various chemical applications. The compound is typically obtained through the catalytic cracking of petroleum or through synthetic organic chemistry methods. Its physical properties, such as boiling point and density, can vary slightly depending on the specific isomeric form. Due to its structure, (±)-2,3-dimethylhexane can participate in various chemical reactions typical of alkanes, including combustion and substitution reactions.

Formula: C₈H₁₈

InChI: InChI=1S/C8H18/c1-5-6-8(4)7(2)3/h7-8H,5-6H2,1-4H3

InChI key: InChIKey=JXPOLSKBTUYKJB-UHFFFAOYSA-N

SMILES: CCCC(C)C(C)C

Synonyms:

• 2,3-Dimethylhexane
• Hexane, 2,3-dimethyl-
• NSC 74170

2,3-Dimethylhexane

CAS: 584-94-1

• Formula: C₈H₁₈
• Purity: >94.0%(GC)
• Color and Shape: Colorless to Almost colorless clear liquid
• Molecular weight: 114.23

PIANO Isoparaffins Mixture 90

CAS: 1067-20-5 107-83-5 108-08-7 15869-87-1 2216-30-0 2216-33-3 3074-71-3 3221-61-2 4032-86-4 4110-44-5 464-06-2 562-49-2 564-02-3 565-59-3 584-94-15881-17-4 589-34-4 589-43-5 589-53-7 589-81-1 590-35-2 590-73-8 591-76-4 5911-04-6 592-13-2 592-27-8 617-78-7 619-99-8 7146-60-3 78-78-4 79-29-8 871-83-0 922-28-1 926-82-9 96-14-0

• Color and Shape: Mixture