CAS 5840-40-4
:3-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-ethoxybenzamide
Description:
3-Bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-ethoxybenzamide is a chemical compound characterized by its complex structure, which includes a bromine atom, an ethoxy group, and a benzamide moiety. The presence of the benzodioxin ring contributes to its unique properties, potentially influencing its reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. The bromine substituent may enhance its reactivity, making it a candidate for further derivatization. Additionally, the ethoxy group can influence the compound's lipophilicity, affecting its absorption and distribution in biological systems. Overall, 3-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-ethoxybenzamide is of interest for its potential applications in drug development and chemical synthesis.
Formula:C17H16BrNO4
InChI:InChI=1/C17H16BrNO4/c1-2-21-14-5-3-11(9-13(14)18)17(20)19-12-4-6-15-16(10-12)23-8-7-22-15/h3-6,9-10H,2,7-8H2,1H3,(H,19,20)
SMILES:CCOc1ccc(cc1Br)C(=Nc1ccc2c(c1)OCCO2)O
Synonyms:- benzamide, 3-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
