CAS 58416-04-9
:2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, dimethyl ester
Description:
2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, dimethyl ester, with the CAS number 58416-04-9, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features two carboxylic acid groups that are esterified with methanol, resulting in dimethyl ester functionality. The presence of hydroxyl groups at the 3 and 4 positions of the thiophene ring contributes to its potential for hydrogen bonding and increases its polarity. This compound is likely to exhibit properties typical of both thiophenes and carboxylic acids, such as moderate solubility in polar solvents and potential reactivity in various chemical reactions, including esterification and oxidation. Its structural features suggest potential applications in organic synthesis, materials science, and possibly in the development of pharmaceuticals or agrochemicals due to the bioactivity often associated with thiophene derivatives. However, specific applications and reactivity would depend on further studies and context within chemical research.
Formula:C8H8O6S
InChI:InChI=1/C8H8O6S/c1-13-7(11)5-3(9)4(10)6(15-5)8(12)14-2/h9-10H,1-2H3
SMILES:COC(=O)c1c(c(c(C(=O)OC)s1)O)O
Synonyms:- Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate
- 3,4-Dihydroxy-2,5-dicarboxythiophene dimethyl ester
- 3,4-Dihydroxy-thiophene-2,5-dicarboxylic acid dimethyl ester
- 3,4-Dihydroxythiophene-2,5-dicarboxylic acid diethyl ester
- (2E,5E)-2,5-bis[hydroxy(methoxy)methylidene]thiophene-3,4(2H,5H)-dione
- 3,4-Dihydroxy-thiophene-2,5-dicarboxylicaciddimethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate
CAS:Formula:C8H8O6SPurity:98%Color and Shape:SolidMolecular weight:232.2105Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate
CAS:Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylatePurity:98%Molecular weight:232.21g/molDimethyl 3,4-Dihydroxy-2,5-thiophenedicarboxylate
CAS:Formula:C8H8O6SPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:232.21Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate
CAS:Formula:C8H8O6SPurity:96%Molecular weight:232.21Dimethyl 3,4-Dihydroxy-2,5-thiophenedicarboxylate
CAS:Dimethyl 3,4-dihydroxy-2,5-thiophenedicarboxylate is an organic compound with the chemical formula CH3COOCH=CHCOOH. It is a white solid that has been used as a raw material in the production of other chemicals. Dimethyl 3,4-dihydroxy-2,5-thiophenedicarboxylate can be produced from benzoic acid and methanol via tetrathiafulvalene catalysis. The yield of this compound is high and it has been shown to have favorable selectivity for the desired product over byproducts. Dimethyl 3,4-dihydroxy-2,5-thiophenedicarboxylate is also a precursor for the synthesis of dimethyl 2,6-diisopropylbenzoate. This compound reacts with ammonia at high temperatures to form methyl 2,6-diisopFormula:C8H8O6SPurity:Min. 95%Molecular weight:232.21 g/mol




