CAS 5843-59-4

6-chloro-9-(5-O-phosphono-beta-D-ribofuranosyl)-9H-purine

Description:

6-Chloro-9-(5-O-phosphono-beta-D-ribofuranosyl)-9H-purine, commonly known as Acyclovir phosphate, is a nucleoside analog with notable antiviral properties, particularly against herpesviruses. This compound features a purine base structure, specifically a 9H-purine ring, which is substituted at the 6-position with a chlorine atom. The molecule also contains a ribofuranosyl sugar moiety, which is further phosphorylated at the 5' position, contributing to its biological activity. The presence of the phosphono group enhances its solubility and stability in biological systems, facilitating its role in inhibiting viral DNA synthesis. Acyclovir phosphate is often utilized in research and therapeutic applications, particularly in the treatment of herpes simplex virus infections. Its mechanism of action involves selective incorporation into viral DNA, leading to chain termination during replication. The compound is typically administered in a phosphorylated form, as the active triphosphate derivative is required for its antiviral activity. Overall, this substance exemplifies the intersection of organic chemistry and pharmacology, showcasing the importance of structural modifications in drug design.

Formula: C₁₀H₁₂ClN₄O₇P

InChI: InChI=1/C10H12ClN4O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,18,19,20)/t4-,6-,7-,10-/m1/s1

SMILES: C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(Cl)ncnc23)O1)O)O)OP(=O)(O)O

6-Chloropurine riboside 5''-monophosphate disodium salt

CAS: 5843-59-4

Purity: ≥ 97%

Color and Shape: Lyophilised powder or solid

Ref: 7W-GN2210

6-Chloropurine riboside 5'-monophosphate disodium salt

CAS: 5843-59-4

6-Chloropurine riboside 5'-monophosphate disodium salt is a synthetic nucleoside that is used as an antiviral and anticancer agent. It is a DNA precursor that can be incorporated into DNA by the enzyme thymidylate synthase to form thymine and diphosphate. 6-Chloropurine riboside 5'-monophosphate disodium salt has been shown to inhibit the replication of some viruses, such as HIV, and also inhibits tumor growth in experimental models.

Formula: C₁₀H₁₀ClN₄Na₂O₇PH₂O

Purity: Min. 95%

Molecular weight: 428.63 g/mol

Ref: 3D-NC29021