CAS 5843-65-2
:Higenamine
Description:
Higenamine, with the CAS number 5843-65-2, is an alkaloid compound primarily derived from various plant sources, including the tubers of the plant *Nandina domestica* and other species. It is known for its potential stimulant and bronchodilator properties, making it of interest in both traditional medicine and modern dietary supplements. Higenamine functions as a beta-adrenergic agonist, which means it can stimulate beta receptors in the body, potentially leading to increased heart rate and improved respiratory function. The compound has garnered attention in sports and fitness contexts for its purported ability to enhance athletic performance and fat metabolism. However, its safety profile and long-term effects are not fully understood, and it may be subject to regulatory scrutiny in various jurisdictions. As with any bioactive compound, it is essential to approach its use with caution, considering potential side effects and interactions with other substances.
Formula:C16H17NO3
InChI:InChI=1S/C16H17NO3/c18-12-3-1-10(2-4-12)7-14-13-9-16(20)15(19)8-11(13)5-6-17-14/h1-4,8-9,14,17-20H,5-7H2
InChI key:InChIKey=WZRCQWQRFZITDX-UHFFFAOYSA-N
SMILES:C(C1C=2C(=CC(O)=C(O)C2)CCN1)C3=CC=C(O)C=C3
Synonyms:- (+/-)-Higenamine
- (RS)-Norcoclaurine
- (±)-Demethylcoclaurine
- (±)-Norcoclaurine
- (±)-O-Demethylcoclaurine
- 1,2,3,4-Tetrahydro-1-[(4-hydroxyphenyl)methyl]-6,7-isoquinolinediol
- 1-(4-Hydroxybenzyl)-1,2,3,4-tetrahydro-6,7-isoquinolinediol
- 1-(4-Hydroxybenzyl)-1,2,3,4-tetrahydroisochinolin-6,7-diol
- 1-[(4-Hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol
- 6,7-Isoquinolinediol, 1,2,3,4-tetrahydro-1-((4-hydroxyphenyl)methyl)-, (+-)-
- Coclaurine, O-demethyl-, (±)-
- Demethyl coclaurine
- Isoquinolin-6,7-diol, 1,2,3,4-tetrahydro-1-[4-hydroxybenzyl]-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Higenamine - natural
CAS:Controlled ProductHigenamine is a natural compound, specifically an alkaloid, which is predominantly sourced from a variety of plants such as Nandina domestica, Aconitum carmichaelii, and others. It functions by interacting with beta-adrenergic receptors, a mechanism similar to that of epinephrine, which results in the stimulation of the sympathetic nervous system.Formula:C16H17NO3Purity:Min. 95%Color and Shape:White PowderMolecular weight:271.31 g/mol(+/-)-Higenamine - synthetic
CAS:Controlled Product(+/-)-Higenamine is a synthetic compound, classified as a beta-adrenergic receptor agonist, which is derived from various plant sources such as Aconitum and Nandina. Its mode of action involves stimulating both the beta-1 and beta-2 adrenergic receptors, leading to increased cardiac output and bronchodilation through the elevation of cyclic adenosine monophosphate (cAMP) levels.Formula:C16H17NO3Purity:Min. 95%Molecular weight:271.31 g/molRef: IN-DA00EDPS
Discontinued product



