CAS 58443-86-0: 1,2,5,6-Tetrabromohexane
Description:1,2,5,6-Tetrabromohexane is a halogenated organic compound characterized by the presence of four bromine atoms attached to a six-carbon hexane backbone. Its molecular structure features bromine substituents at the first, second, fifth, and sixth carbon positions, which significantly influence its physical and chemical properties. This compound is typically a colorless to pale yellow liquid, exhibiting high density and low volatility due to the presence of bromine, which increases molecular weight. It is relatively insoluble in water but soluble in organic solvents. 1,2,5,6-Tetrabromohexane is known for its applications in various fields, including as a flame retardant and in chemical synthesis. The presence of multiple bromine atoms also imparts notable reactivity, making it susceptible to nucleophilic substitution reactions. Safety considerations are important when handling this compound, as brominated compounds can pose environmental and health risks. Proper storage and disposal methods should be followed to mitigate any potential hazards associated with its use.
Formula:C6H10Br4
InChI:InChI=1S/C6H10Br4/c7-3-5(9)1-2-6(10)4-8/h5-6H,1-4H2
InChI key:InChIKey=WPBWUVCMCYXPFI-UHFFFAOYSA-N
SMILES:BrCC(Br)CCC(Br)CBr
- Synonyms:
- Hexane, 1,2,5,6-tetrabromo-
- 1,2,5,6-Tetrabromohexane
1,2,5,6-TETRABROMOHEXANE
Ref: IN-DA003DBG
| 5g | 129.00 € |
Ref: 54-OR1028371
| 1g | 38.00 € | ||
| 5g | 113.00 € | ||
| 25g | 415.00 € | ||
| 100g | 1,094.00 € | ||
| 250mg | 32.00 € |
1,2,5,6-Tetrabromohexane (mixture of diastereoisomers)
Ref: 3B-T2983
| 5g | 90.00 € | ||
| 25g | 329.00 € |
1,2,5,6-Tetrabromohexane (mixture of diastereoisomers)
Ref: 3D-ICA44386
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information | |
| 100g | Discontinued | Request information |
